Difference between revisions of "PWY-6365"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12581 CPD-12581] ==
+== Pathway PWY-5399 ==
+* taxonomic-range:
+** tax-4751
+** tax-3524
 * common-name:
-** s-(2e,6e)-farnesyl-l-cysteine
+** betacyanin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(c)=cccc(c)=cccc(c)=ccscc([n+])c(=o)[o-]
+* [[RXN-13061]]
-* inchi-key:
+* [[RXN-5861]]
-** syslnqmklrogcl-bcyuyympsa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-8480 RXN-8480]
-** 325.508
+* [NoneRXN-8478 RXN-8478]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-8479 RXN-8479]
-* [[RXN-11623]]
+* [NoneRXN-8483 RXN-8483]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-8482 RXN-8482]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-8481 RXN-8481]
-{{#set: common-name=s-(2e,6e)-farnesyl-l-cysteine}}
+{{#set: taxonomic-range=tax-3524|tax-4751}}
-{{#set: inchi-key=inchikey=syslnqmklrogcl-bcyuyympsa-n}}
+{{#set: common-name=betacyanin biosynthesis}}
-{{#set: molecular-weight=325.508}}
+{{#set: nb reaction found=2}}
+{{#set: completion rate=0.25}}
+{{#set: nb total reaction=8}}