Difference between revisions of "PWY-5491"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-COUMAROYL-COA P-COUMAROYL-COA] ==
+== Pathway PWY-5491 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 4-coumaroyl-coa
+** diethylphosphate degradation
-* smiles:
+== Reaction(s) found ==
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+* [[RXN-8748]]
-* inchi-key:
+== Reaction(s) not found ==
-** dmzokbalnzwdki-matmfaihsa-j
+* [NoneRXN-8747 RXN-8747]
-* molecular-weight:
+{{#set: taxonomic-range=tax-2}}
-** 909.648
+{{#set: common-name=diethylphosphate degradation}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[NARINGENIN-CHALCONE-SYNTHASE-RXN]]
+{{#set: completion rate=0.5}}
-* [[RXN-1101]]
+{{#set: nb total reaction=2}}
-* [[RXN-11244]]
-* [[RXN-3142]]
-== Reaction(s) known to produce the compound ==
-* [[4-COUMARATE--COA-LIGASE-RXN]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=4-coumaroyl-coa}}
-{{#set: inchi-key=inchikey=dmzokbalnzwdki-matmfaihsa-j}}
-{{#set: molecular-weight=909.648}}