Difference between revisions of "PWY66-391"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEPHOSPHO-COA DEPHOSPHO-COA] ==
+== Pathway PWY-5 ==
+* taxonomic-range:
+** tax-3803
 * common-name:
-** 3'-dephospho-coa
+** canavanine biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(c)(cop(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))))c(o)c(=o)nccc(=o)nccs
+* [[RXN-10]]
-* inchi-key:
+* [[RXN-22]]
-** kdtshfargakyjn-ibosznhhsa-l
+* [[RXN-9]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 685.538
+* [NoneRXN-25 RXN-25]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-3803}}
-* [[ADCPT]]
+{{#set: common-name=canavanine biosynthesis}}
-* [[DEPHOSPHOCOAKIN-RXN]]
+{{#set: nb reaction found=3}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.75}}
-* [[PANTEPADENYLYLTRAN-RXN]]
+{{#set: nb total reaction=4}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=3'-dephospho-coa}}
-{{#set: inchi-key=inchikey=kdtshfargakyjn-ibosznhhsa-l}}
-{{#set: molecular-weight=685.538}}