Difference between revisions of "PWY0-1573"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] == * common-name: ** 4-prenylphlorisovalerophenone * smiles: ** cc(=ccc1(=c(...")
(Created page with "Category:pathway == Pathway PWY0-1573 == * common-name: ** nitrate reduction viiib (dissimilatory) == Reaction(s) found == * RXN0-5330 == Reaction(s) not found == * [N...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7109 CPD-7109] ==
+
== Pathway PWY0-1573 ==
 
* common-name:
 
* common-name:
** 4-prenylphlorisovalerophenone
+
** nitrate reduction viiib (dissimilatory)
* smiles:
+
== Reaction(s) found ==
** cc(=ccc1(=c(c=c(c(=c1o)c(cc(c)c)=o)o)[o-]))c
+
* [[RXN0-5330]]
* inchi-key:
+
== Reaction(s) not found ==
** lwlgkghhvbvdkb-uhfffaoysa-m
+
* [NoneRXN0-7124 RXN0-7124]
* molecular-weight:
+
{{#set: common-name=nitrate reduction viiib (dissimilatory)}}
** 277.339
+
{{#set: nb reaction found=1}}
== Reaction(s) known to consume the compound ==
+
{{#set: completion rate=0.5}}
* [[RXN-7810]]
+
{{#set: nb total reaction=2}}
== Reaction(s) known to produce the compound ==
 
* [[RXN-7811]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=4-prenylphlorisovalerophenone}}
 
{{#set: inchi-key=inchikey=lwlgkghhvbvdkb-uhfffaoysa-m}}
 
{{#set: molecular-weight=277.339}}
 

Revision as of 20:16, 18 December 2020

Pathway PWY0-1573

  • common-name:
    • nitrate reduction viiib (dissimilatory)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN0-7124 RXN0-7124]