Difference between revisions of "PWY-7270"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17638 CPD-17638] ==
+== Pathway PWY-7414 ==
+* taxonomic-range:
+** tax-1883
 * common-name:
-** 7-hydroxylauroyl-coa
+** dtdp-&alpha;-d-mycaminose biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cccccc(o)cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[DTDPGLUCDEHYDRAT-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** rxedusgpuqqzew-xirpngcasa-j
+* [NoneRXN-12840 RXN-12840]
-* molecular-weight:
+* [NoneRXN-12810 RXN-12810]
-** 961.807
+* [NoneDTDPGLUCOSEPP-RXN DTDPGLUCOSEPP-RXN]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-12772 RXN-12772]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-1883}}
-* [[RXN-12184]]
+{{#set: common-name=dtdp-&alpha;-d-mycaminose biosynthesis}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=1}}
-{{#set: common-name=7-hydroxylauroyl-coa}}
+{{#set: completion rate=0.2}}
-{{#set: inchi-key=inchikey=rxedusgpuqqzew-xirpngcasa-j}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=961.807}}