Difference between revisions of "ASPARTATESYN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S] == * common-name: ** 4...")
(Created page with "Category:pathway == Pathway PWY-5108 == * taxonomic-range: ** tax-224756 ** tax-2 ** tax-183925 * common-name: ** l-isoleucine biosynthesis v == Reaction(s) found == * 2...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S] ==
+
== Pathway PWY-5108 ==
 +
* taxonomic-range:
 +
** tax-224756
 +
** tax-2
 +
** tax-183925
 
* common-name:
 
* common-name:
** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate
+
** l-isoleucine biosynthesis v
* smiles:
+
== Reaction(s) found ==
** cc(=o)nc2(c(o)oc(cos(=o)(=o)[o-])c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
+
* [[2KETO-3METHYLVALERATE-RXN]]
* inchi-key:
+
* [[BRANCHED-CHAINAMINOTRANSFERILEU-RXN]]
** bujztfindcqrgp-ztvljyeesa-l
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneRXN-18448 RXN-18448]
** 457.362
+
* [NoneRXN-19503 RXN-19503]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-224756|tax-183925|tax-2}}
* [[RXN-12177]]
+
{{#set: common-name=l-isoleucine biosynthesis v}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=2}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.67}}
{{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate}}
+
{{#set: nb total reaction=3}}
{{#set: inchi-key=inchikey=bujztfindcqrgp-ztvljyeesa-l}}
 
{{#set: molecular-weight=457.362}}
 

Revision as of 20:16, 18 December 2020

Pathway PWY-5108

  • taxonomic-range:
    • tax-224756
    • tax-2
    • tax-183925
  • common-name:
    • l-isoleucine biosynthesis v

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-18448 RXN-18448]
  • [NoneRXN-19503 RXN-19503]