Difference between revisions of "PWY66-3"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRO-DIOH-BENZOATE DIHYDRO-DIOH-BENZOATE] ==
+== Pathway PWY-6588 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** (2s,3s)-2,3-dihydroxy-2,3-dihydrobenzoate
+** pyruvate fermentation to acetone
-* smiles:
+== Reaction(s) found ==
-** c([o-])(=o)c1(=cc=cc(c1o)o)
+* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
-* inchi-key:
+* [[PYRUFLAVREDUCT-RXN]]
-** incswykiciyahb-wdskdsinsa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneACETOACETATE-DECARBOXYLASE-RXN ACETOACETATE-DECARBOXYLASE-RXN]
-** 155.13
+* [None2.8.3.9-RXN 2.8.3.9-RXN]
-== Reaction(s) known to consume the compound ==
+* [NoneACETOACETYL-COA-TRANSFER-RXN ACETOACETYL-COA-TRANSFER-RXN]
-* [[DHBDEHYD-RXN]]
+{{#set: taxonomic-range=tax-2}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=pyruvate fermentation to acetone}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=2}}
-{{#set: common-name=(2s,3s)-2,3-dihydroxy-2,3-dihydrobenzoate}}
+{{#set: completion rate=0.4}}
-{{#set: inchi-key=inchikey=incswykiciyahb-wdskdsinsa-m}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=155.13}}