Difference between revisions of "PWY-6644"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE 2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE] == * common-name: **...")
(Created page with "Category:pathway == Pathway PWY-5515 == * taxonomic-range: ** tax-4751 * common-name: ** l-arabinose degradation ii == Reaction(s) found == * L-XYLULOSE-REDUCTASE-RXN...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE 2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE] ==
+
== Pathway PWY-5515 ==
 +
* taxonomic-range:
 +
** tax-4751
 
* common-name:
 
* common-name:
** 2-carboxy-d-arabinitol 1-phosphate
+
** l-arabinose degradation ii
* smiles:
+
== Reaction(s) found ==
** c(c(c(c(cop([o-])([o-])=o)(c([o-])=o)o)o)o)o
+
* [[L-XYLULOSE-REDUCTASE-RXN]]
* inchi-key:
+
* [[RXN-8772]]
** ujtmirnfexkgms-uhfffaoysa-k
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneL-ARABINITOL-4-DEHYDROGENASE-RXN L-ARABINITOL-4-DEHYDROGENASE-RXN]
** 273.113
+
{{#set: taxonomic-range=tax-4751}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=l-arabinose degradation ii}}
* [[2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE-RXN]]
+
{{#set: nb reaction found=2}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=0.67}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=3}}
{{#set: common-name=2-carboxy-d-arabinitol 1-phosphate}}
 
{{#set: inchi-key=inchikey=ujtmirnfexkgms-uhfffaoysa-k}}
 
{{#set: molecular-weight=273.113}}
 

Revision as of 20:17, 18 December 2020

Pathway PWY-5515

  • taxonomic-range:
    • tax-4751
  • common-name:
    • l-arabinose degradation ii

Reaction(s) found

Reaction(s) not found

  • [NoneL-ARABINITOL-4-DEHYDROGENASE-RXN L-ARABINITOL-4-DEHYDROGENASE-RXN]