Difference between revisions of "SJ06433"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Monocarboxylates Monocarboxylates] == * common-name: ** a monocarboxylate == Reaction(s) known...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == * common-name: ** salicyl-6-hydroxy-2-cyclohexene-on-oyl * smiles: ** c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13174 CPD-13174] == |
* common-name: | * common-name: | ||
| − | ** | + | ** salicyl-6-hydroxy-2-cyclohexene-on-oyl |
| + | * smiles: | ||
| + | ** c(c1(o)(c(=o)ccc=c1))(occ2(c(o)=cc=cc=2))=o | ||
| + | * inchi-key: | ||
| + | ** wyymyyoxcoemcu-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 262.262 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12252]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=salicyl-6-hydroxy-2-cyclohexene-on-oyl}} |
| + | {{#set: inchi-key=inchikey=wyymyyoxcoemcu-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=262.262}} | ||
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-13174
- common-name:
- salicyl-6-hydroxy-2-cyclohexene-on-oyl
- smiles:
- c(c1(o)(c(=o)ccc=c1))(occ2(c(o)=cc=cc=2))=o
- inchi-key:
- wyymyyoxcoemcu-uhfffaoysa-n
- molecular-weight:
- 262.262
