Difference between revisions of "PWY-7455"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THIAMINE-PYROPHOSPHATE THIAMINE-PYROPHOSPHATE] ==
+== Pathway PWY0-1535 ==
+* taxonomic-range:
+** tax-2759
+** tax-2
 * common-name:
-** thiamine diphosphate
+** d-serine degradation
-* smiles:
+== Reaction(s) found ==
-** cc1([n+](=csc(ccop([o-])(=o)op([o-])(=o)[o-])=1)cc2(c=nc(c)=nc(n)=2))
+* [[RXN-15581]]
-* inchi-key:
+== Reaction(s) not found ==
-** ayekofbpnlcajy-uhfffaoysa-l
+* [NoneRXN-15127 RXN-15127]
-* molecular-weight:
+* [NoneRXN-15124 RXN-15124]
-** 422.288
+{{#set: taxonomic-range=tax-2|tax-2759}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=d-serine degradation}}
-* [[RXN-12583]]
+{{#set: nb reaction found=1}}
-* [[RXN-14037]]
+{{#set: completion rate=0.33}}
-* [[RXN0-3542]]
+{{#set: nb total reaction=3}}
-== Reaction(s) known to produce the compound ==
-* [[PDHam2hi]]
-* [[PDHam2mi]]
-* [[RXN-12508]]
-* [[RXN-14037]]
-* [[RXN0-3542]]
-* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
-* [[THIAMIN-TRIPHOSPHATASE-RXN]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=thiamine diphosphate}}
-{{#set: inchi-key=inchikey=ayekofbpnlcajy-uhfffaoysa-l}}
-{{#set: molecular-weight=422.288}}