Difference between revisions of "PWY-842"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7063 CPD-7063] == * common-name: ** red chlorophyll catabolite * smiles: ** ccc1(c(c)=c(nc=...")
(Created page with "Category:pathway == Pathway PWY-5480 == * taxonomic-range: ** tax-3041 ** tax-4751 ** tax-2 * common-name: ** pyruvate fermentation to ethanol i == Reaction(s) found == *...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7063 CPD-7063] ==
+
== Pathway PWY-5480 ==
 +
* taxonomic-range:
 +
** tax-3041
 +
** tax-4751
 +
** tax-2
 
* common-name:
 
* common-name:
** red chlorophyll catabolite
+
** pyruvate fermentation to ethanol i
* smiles:
+
== Reaction(s) found ==
** ccc1(c(c)=c(nc=1c=c4(c(c)=c5(c(=o)[c-](c(oc)=o)c(c2(c(ccc(=o)[o-])c(c)c(n=2)=cc3(c(c)=c(c=c)c(=o)n3)))=c(n4)5)))c=o)
+
* [[ALCOHOL-DEHYDROG-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** gvtpycxgtfqzdt-yssugppcsa-m
+
* [NoneACETALD-DEHYDROG-RXN ACETALD-DEHYDROG-RXN]
* molecular-weight:
+
* [NonePYRUVFORMLY-RXN PYRUVFORMLY-RXN]
** 624.692
+
{{#set: taxonomic-range=tax-2|tax-3041|tax-4751}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=pyruvate fermentation to ethanol i}}
* [[RXN-7741]]
+
{{#set: nb reaction found=1}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=0.33}}
* [[RXN-7740]]
+
{{#set: nb total reaction=3}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=red chlorophyll catabolite}}
 
{{#set: inchi-key=inchikey=gvtpycxgtfqzdt-yssugppcsa-m}}
 
{{#set: molecular-weight=624.692}}
 

Revision as of 20:17, 18 December 2020

Pathway PWY-5480

  • taxonomic-range:
    • tax-3041
    • tax-4751
    • tax-2
  • common-name:
    • pyruvate fermentation to ethanol i

Reaction(s) found

Reaction(s) not found

  • [NoneACETALD-DEHYDROG-RXN ACETALD-DEHYDROG-RXN]
  • [NonePYRUVFORMLY-RXN PYRUVFORMLY-RXN]