Difference between revisions of "LIPASYN-PWY"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTETRAOSE MALTOTETRAOSE] ==
+== Pathway PWY-5874 ==
+* taxonomic-range:
+** tax-2759
 * common-name:
-** maltotetraose
+** heme degradation i
-* smiles:
+== Reaction(s) found ==
-** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o
+* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** luewuzlmquobsb-ayqjavfrsa-n
+* [NoneRXN-19359 RXN-19359]
-* molecular-weight:
+* [NoneRXN-19361 RXN-19361]
-** 666.583
+* [NoneRXN-19358 RXN-19358]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-19360 RXN-19360]
-* [[RXN0-5182]]
+* [NoneBILIVERDIN-REDUCTASE-RXN BILIVERDIN-REDUCTASE-RXN]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-2759}}
-* [[GLYMALTOPHOSPHORYL-RXN]]
+{{#set: common-name=heme degradation i}}
-* [[RXN-14281]]
+{{#set: nb reaction found=1}}
-* [[RXN-14284]]
+{{#set: completion rate=0.17}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=6}}
-{{#set: common-name=maltotetraose}}
-{{#set: inchi-key=inchikey=luewuzlmquobsb-ayqjavfrsa-n}}
-{{#set: molecular-weight=666.583}}