Difference between revisions of "PWY-7761"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UROPORPHYRINOGEN-III UROPORPHYRINOGEN-III] ==
+== Pathway PWY-6308 ==
+* taxonomic-range:
+** tax-28890
 * common-name:
-** uroporphyrinogen-iii
+** l-cysteine biosynthesis ii (trna-dependent)
-* smiles:
+== Reaction(s) found ==
-** c(=o)([o-])ccc3(c(=c2(cc5(nc(cc4(nc(cc1(nc(=c(c=1cc(=o)[o-])ccc(=o)[o-])cc(n2)=3))=c(cc(=o)[o-])c=4ccc(=o)[o-]))=c(cc([o-])=o)c(ccc(=o)[o-])=5)))cc(=o)[o-])
+* [[RXN-16637]]
-* inchi-key:
+== Reaction(s) not found ==
-** huhwzxwwofsfkf-uhfffaoysa-f
+* [NoneRXN-10718 RXN-10718]
-* molecular-weight:
+* [NoneRXN-10719 RXN-10719]
-** 828.742
+{{#set: taxonomic-range=tax-28890}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=l-cysteine biosynthesis ii (trna-dependent)}}
-* [[RXN-13403]]
+{{#set: nb reaction found=1}}
-* [[UROGENDECARBOX-RXN]]
+{{#set: completion rate=0.33}}
-* [[UROPORIIIMETHYLTRANSA-RXN]]
+{{#set: nb total reaction=3}}
-== Reaction(s) known to produce the compound ==
-* [[UROGENIIISYN-RXN]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=uroporphyrinogen-iii}}
-{{#set: inchi-key=inchikey=huhwzxwwofsfkf-uhfffaoysa-f}}
-{{#set: molecular-weight=828.742}}