Difference between revisions of "PWY-6538"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_ACETATE_AUXIN INDOLE_ACETATE_AUXIN] ==
+== Pathway PWY-5390 ==
+* taxonomic-range:
+** tax-3398
 * common-name:
-** (indol-3-yl)acetate
+** rutin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c([o-])(=o)cc1(=cnc2(c=cc=cc1=2))
+* [[RXN-527]]
-* inchi-key:
+* [[RXN1F-462]]
-** seovtrfcigrimh-uhfffaoysa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-8449 RXN-8449]
-** 174.179
+{{#set: taxonomic-range=tax-3398}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=rutin biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=2}}
-* [[RXN-10711]]
+{{#set: completion rate=0.67}}
-* [[RXN-10715]]
+{{#set: nb total reaction=3}}
-* [[RXN-1404]]
-* [[RXN-5581]]
-* [[RXNDQC-2]]
-* [[RXNN-404]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=(indol-3-yl)acetate}}
-{{#set: inchi-key=inchikey=seovtrfcigrimh-uhfffaoysa-m}}
-{{#set: molecular-weight=174.179}}