Difference between revisions of "PWY-5154"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14646 CPD-14646] ==
+== Pathway P221-PWY ==
+* taxonomic-range:
+** tax-4751
+** tax-2
 * common-name:
-** 9-cis-&beta;-carotene
+** octane oxidation
-* smiles:
+== Reaction(s) found ==
-** cc(c=cc=c(c)c=cc1(=c(c)cccc(c)(c)1))=cc=cc=c(c=cc=c(c=cc2(=c(cccc2(c)c)c))c)c
+* [[ALKANE-1-MONOOXYGENASE-RXN]]
-* inchi-key:
+* [[R222-RXN]]
-** oenhqhleoonyie-bvzamqqesa-n
+* [[R223-RXN]]
-* molecular-weight:
+== Reaction(s) not found ==
-** 536.882
+* [NoneRUBREDOXIN--NAD+-REDUCTASE-RXN RUBREDOXIN--NAD+-REDUCTASE-RXN]
-== Reaction(s) known to consume the compound ==
+* [NoneR221-RXN R221-RXN]
-* [[RXN-13641]]
+{{#set: taxonomic-range=tax-2|tax-4751}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=octane oxidation}}
-* [[RXN-13641]]
+{{#set: nb reaction found=3}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.6}}
-{{#set: common-name=9-cis-&beta;-carotene}}
+{{#set: nb total reaction=5}}
-{{#set: inchi-key=inchikey=oenhqhleoonyie-bvzamqqesa-n}}
-{{#set: molecular-weight=536.882}}