Difference between revisions of "PWY-6691"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEHYDRO-SHIKIMATE 3-DEHYDRO-SHIKIMATE] == * common-name: ** 3-dehydroshikimate * smiles: ** c...")
(Created page with "Category:pathway == Pathway PWY-7165 == * taxonomic-range: ** tax-2 * common-name: ** l-ascorbate biosynthesis vi (engineered pathway) == Reaction(s) found == * GLUCONOL...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEHYDRO-SHIKIMATE 3-DEHYDRO-SHIKIMATE] ==
+
== Pathway PWY-7165 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** 3-dehydroshikimate
+
** l-ascorbate biosynthesis vi (engineered pathway)
* smiles:
+
== Reaction(s) found ==
** c([o-])(=o)c1(=cc(=o)c(o)c(o)c1)
+
* [[GLUCONOLACT-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** slwwjzmphjjoph-phdidxhhsa-m
+
* [NoneRXN-12108 RXN-12108]
* molecular-weight:
+
* [None1.1.1.274-RXN 1.1.1.274-RXN]
** 171.129
+
* [NoneRXN0-6373 RXN0-6373]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN0-7020 RXN0-7020]
* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
+
* [NoneDEHYDROGLUCONATE-DEHYDROGENASE-RXN DEHYDROGLUCONATE-DEHYDROGENASE-RXN]
* [[SHIKIMATE-5-DEHYDROGENASE-RXN]]
+
* [NoneGLUCONATE-2-DEHYDROGENASE-RXN GLUCONATE-2-DEHYDROGENASE-RXN]
== Reaction(s) known to produce the compound ==
+
{{#set: taxonomic-range=tax-2}}
* [[3-DEHYDROQUINATE-DEHYDRATASE-RXN]]
+
{{#set: common-name=l-ascorbate biosynthesis vi (engineered pathway)}}
* [[RXN-7968]]
+
{{#set: nb reaction found=1}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.14}}
{{#set: common-name=3-dehydroshikimate}}
+
{{#set: nb total reaction=7}}
{{#set: inchi-key=inchikey=slwwjzmphjjoph-phdidxhhsa-m}}
 
{{#set: molecular-weight=171.129}}
 

Revision as of 20:18, 18 December 2020

Pathway PWY-7165

  • taxonomic-range:
    • tax-2
  • common-name:
    • l-ascorbate biosynthesis vi (engineered pathway)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-12108 RXN-12108]
  • [None1.1.1.274-RXN 1.1.1.274-RXN]
  • [NoneRXN0-6373 RXN0-6373]
  • [NoneRXN0-7020 RXN0-7020]
  • [NoneDEHYDROGLUCONATE-DEHYDROGENASE-RXN DEHYDROGLUCONATE-DEHYDROGENASE-RXN]
  • [NoneGLUCONATE-2-DEHYDROGENASE-RXN GLUCONATE-2-DEHYDROGENASE-RXN]