Difference between revisions of "TRNA-CHARGING-PWY"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBOSE-1-ARSENATE RIBOSE-1-ARSENATE] ==
+== Pathway PWY-6704 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** ribose-1-arsenate
+** l-ascorbate degradation iv
-* smiles:
+== Reaction(s) found ==
-** c(o)c1(c(o)c(o)c(o[as]([o-])(=o)[o-])o1)
+* [[RXN-12107]]
-* inchi-key:
+== Reaction(s) not found ==
-** ryjjomqpaaufbf-txicztdvsa-l
+* [NoneRXN-12110 RXN-12110]
-* molecular-weight:
+* [NoneRXN-12109 RXN-12109]
-** 272.043
+* [NoneRXN-12108 RXN-12108]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN0-7021 RXN0-7021]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-33090}}
-* [[RXN-7001]]
+{{#set: common-name=l-ascorbate degradation iv}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=1}}
-{{#set: common-name=ribose-1-arsenate}}
+{{#set: completion rate=0.2}}
-{{#set: inchi-key=inchikey=ryjjomqpaaufbf-txicztdvsa-l}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=272.043}}