Difference between revisions of "PWY-6174"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN 3-METHYL-1-246-TRIHYDROXYPHENYLBUTAN] ==
+== Pathway PWY-3121 ==
+* taxonomic-range:
+** tax-3465
+** tax-4004
+** tax-3803
+** tax-3977
+** tax-4210
 * common-name:
-** phlorisovalerophenone
+** linamarin degradation
-* smiles:
+== Reaction(s) found ==
-** cc(cc(c1(c(=cc(=cc=1o)o)o))=o)c
+* [[RXN-5341]]
-* inchi-key:
+== Reaction(s) not found ==
-** vsdwhzgjgwmirn-uhfffaoysa-n
+* [NoneACETONE-CYANHYDRIN-LYASE-RXN ACETONE-CYANHYDRIN-LYASE-RXN]
-* molecular-weight:
+{{#set: taxonomic-range=tax-3977|tax-4210|tax-4004|tax-3465|tax-3803}}
-** 210.229
+{{#set: common-name=linamarin degradation}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-7811]]
+{{#set: completion rate=0.5}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=2}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=phlorisovalerophenone}}
-{{#set: inchi-key=inchikey=vsdwhzgjgwmirn-uhfffaoysa-n}}
-{{#set: molecular-weight=210.229}}