Difference between revisions of "PWY-5426"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12601 CPD-12601] == * common-name: ** β-d-mannopyranose * smiles: ** c(o)c1(c(o)c(o)c(...")
(Created page with "Category:pathway == Pathway PWY-5600 == * taxonomic-range: ** tax-2759 * common-name: ** pyruvate fermentation to acetate vii == Reaction(s) found == * PYRUFLAVREDUCT-RX...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12601 CPD-12601] ==
+
== Pathway PWY-5600 ==
 +
* taxonomic-range:
 +
** tax-2759
 
* common-name:
 
* common-name:
** β-d-mannopyranose
+
** pyruvate fermentation to acetate vii
* smiles:
+
== Reaction(s) found ==
** c(o)c1(c(o)c(o)c(o)c(o)o1)
+
* [[PYRUFLAVREDUCT-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** wqzgkkkjijffok-rwopyejcsa-n
+
All reactions of this pathways are in present
* molecular-weight:
+
{{#set: taxonomic-range=tax-2759}}
** 180.157
+
{{#set: common-name=pyruvate fermentation to acetate vii}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37.]]
+
{{#set: completion rate=1.0}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb total reaction=1}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=β-d-mannopyranose}}
 
{{#set: inchi-key=inchikey=wqzgkkkjijffok-rwopyejcsa-n}}
 
{{#set: molecular-weight=180.157}}
 

Revision as of 20:18, 18 December 2020

Pathway PWY-5600

  • taxonomic-range:
    • tax-2759
  • common-name:
    • pyruvate fermentation to acetate vii

Reaction(s) found

Reaction(s) not found

All reactions of this pathways are in present