Difference between revisions of "SJ11289"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] == * common-name: ** 2-hydroxy-datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(n)=n...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MI-HEXAKISPHOSPHATE MI-HEXAKISPHOSPHATE] == * common-name: ** phytate * smiles: ** c1(op([o-])(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MI-HEXAKISPHOSPHATE MI-HEXAKISPHOSPHATE] ==
 
* common-name:
 
* common-name:
** 2-hydroxy-datp
+
** phytate
 
* smiles:
 
* smiles:
** c(c3(c(cc(n2(c1(=c(c(n)=nc(=o)n1)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
+
** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op([o-])([o-])=o)1)
 
* inchi-key:
 
* inchi-key:
** uoacbprdwrdehj-kvqbguixsa-j
+
** imqlkjbteoyosi-gpivlxjgsa-b
 
* molecular-weight:
 
* molecular-weight:
** 503.152
+
** 647.942
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-6957]]
+
* [[2.7.1.152-RXN]]
 +
* [[RXN-10971]]
 +
* [[RXN-10972]]
 +
* [[RXN-10977]]
 +
* [[RXN-10978]]
 +
* [[RXN-7186]]
 +
* [[RXN-7241]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10964]]
 +
* [[RXN-10977]]
 +
* [[RXN-10978]]
 +
* [[RXN-7163]]
 +
* [[RXN-7186]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-hydroxy-datp}}
+
{{#set: common-name=phytate}}
{{#set: inchi-key=inchikey=uoacbprdwrdehj-kvqbguixsa-j}}
+
{{#set: inchi-key=inchikey=imqlkjbteoyosi-gpivlxjgsa-b}}
{{#set: molecular-weight=503.152}}
+
{{#set: molecular-weight=647.942}}

Revision as of 14:20, 26 August 2019

Metabolite MI-HEXAKISPHOSPHATE

  • common-name:
    • phytate
  • smiles:
    • c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op([o-])([o-])=o)1)
  • inchi-key:
    • imqlkjbteoyosi-gpivlxjgsa-b
  • molecular-weight:
    • 647.942

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality