Difference between revisions of "SJ11289"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13851 CPD-13851] == * common-name: ** 2-hydroxy-datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(n)=n...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MI-HEXAKISPHOSPHATE MI-HEXAKISPHOSPHATE] == * common-name: ** phytate * smiles: ** c1(op([o-])(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MI-HEXAKISPHOSPHATE MI-HEXAKISPHOSPHATE] == |
* common-name: | * common-name: | ||
− | ** | + | ** phytate |
* smiles: | * smiles: | ||
− | ** | + | ** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op([o-])([o-])=o)1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** imqlkjbteoyosi-gpivlxjgsa-b |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 647.942 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.7.1.152-RXN]] |
+ | * [[RXN-10971]] | ||
+ | * [[RXN-10972]] | ||
+ | * [[RXN-10977]] | ||
+ | * [[RXN-10978]] | ||
+ | * [[RXN-7186]] | ||
+ | * [[RXN-7241]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-10964]] | ||
+ | * [[RXN-10977]] | ||
+ | * [[RXN-10978]] | ||
+ | * [[RXN-7163]] | ||
+ | * [[RXN-7186]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=phytate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=imqlkjbteoyosi-gpivlxjgsa-b}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=647.942}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite MI-HEXAKISPHOSPHATE
- common-name:
- phytate
- smiles:
- c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op([o-])([o-])=o)1)
- inchi-key:
- imqlkjbteoyosi-gpivlxjgsa-b
- molecular-weight:
- 647.942