Difference between revisions of "LEUSYN-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13205 CPD-13205] == * common-name: ** cellotetraose * smiles: ** c(c(c(c(c(co)o)oc1(c(c(c(c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYOX GLYOX] == * common-name: ** glyoxylate * smiles: ** [ch](c(=o)[o-])=o * inchi-key: ** hhl...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13205 CPD-13205] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYOX GLYOX] ==
 
* common-name:
 
* common-name:
** cellotetraose
+
** glyoxylate
 
* smiles:
 
* smiles:
** c(c(c(c(c(co)o)oc1(c(c(c(c(co)o1)oc2(c(c(c(c(co)o2)oc3(c(c(c(c(co)o3)o)o)o))o)o))o)o))o)o)=o
+
** [ch](c(=o)[o-])=o
 
* inchi-key:
 
* inchi-key:
** uyqjcpnsavwafu-zeuiethysa-n
+
** hhlfwlyxyjoton-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 666.583
+
** 73.028
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12305]]
+
* [[4OH2OXOGLUTARALDOL-RXN]]
 +
* [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]]
 +
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 +
* [[GLYOXYLATE-OXIDASE-RXN]]
 +
* [[GLYOXYLATE-REDUCTASE-NADP+-RXN]]
 +
* [[ISOCIT-CLEAV-RXN]]
 +
* [[MALSYN-RXN]]
 +
* [[RXN-13990]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.4.3.19-RXN]]
 +
* [[4OH2OXOGLUTARALDOL-RXN]]
 +
* [[ALANINE--GLYOXYLATE-AMINOTRANSFERASE-RXN]]
 +
* [[GLYCINE-AMINOTRANSFERASE-RXN]]
 +
* [[GLYCOLATEDEHYDRO-RXN]]
 +
* [[HDAO10x]]
 +
* [[ISOCIT-CLEAV-RXN]]
 +
* [[RXN-13990]]
 +
* [[RXN-17951]]
 +
* [[RXN-8673]]
 +
* [[RXN-8674]]
 +
* [[RXN-969]]
 +
* [[RXN0-7229]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cellotetraose}}
+
{{#set: common-name=glyoxylate}}
{{#set: inchi-key=inchikey=uyqjcpnsavwafu-zeuiethysa-n}}
+
{{#set: inchi-key=inchikey=hhlfwlyxyjoton-uhfffaoysa-m}}
{{#set: molecular-weight=666.583}}
+
{{#set: molecular-weight=73.028}}

Revision as of 14:18, 26 August 2019