Difference between revisions of "SJ10320"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYADENOSINE DEOXYADENOSINE] == * common-name: ** 2'-deoxyadenosine * smiles: ** c(o)c1(oc(cc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17545 CPD-17545] == * common-name: ** 3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17545 CPD-17545] == |
* common-name: | * common-name: | ||
| − | ** 2 | + | ** 3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l-alanine |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c([n+])c(c([o-])=o)nc(=o)c1(oc(c(=o)n)1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** neroffugairxgm-wxjvfsnfsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 217.181 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16294]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16294]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=2 | + | {{#set: common-name=3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l-alanine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=neroffugairxgm-wxjvfsnfsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=217.181}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-17545
- common-name:
- 3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l-alanine
- smiles:
- c([n+])c(c([o-])=o)nc(=o)c1(oc(c(=o)n)1)
- inchi-key:
- neroffugairxgm-wxjvfsnfsa-n
- molecular-weight:
- 217.181
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l-alanine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
