Difference between revisions of "SJ19995"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-L-cysteine-sulfonate N-terminal-L-cysteine-sulfonate] == * common-name: ** an n-term...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-6P MANNOSE-6P] == * common-name: ** α-d-mannopyranose 6-phosphate * smiles: ** c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-terminal-L-cysteine-sulfonate N-terminal-L-cysteine-sulfonate] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-6P MANNOSE-6P] ==
 
* common-name:
 
* common-name:
** an n-terminal 3-sulfo-l-alanyl-[protein]
+
** α-d-mannopyranose 6-phosphate
 +
* smiles:
 +
** c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1)
 +
* inchi-key:
 +
** nbschqhzlsjfnq-pqmkyfcfsa-l
 +
* molecular-weight:
 +
** 258.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17891]]
+
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
 +
* [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37.]]
 +
* [[MANNKIN-RXN-D-mannopyranose/ATP//MANNOSE-6P/ADP/PROTON.43.]]
 +
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]]
 +
* [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n-terminal 3-sulfo-l-alanyl-[protein]}}
+
{{#set: common-name=α-d-mannopyranose 6-phosphate}}
 +
{{#set: inchi-key=inchikey=nbschqhzlsjfnq-pqmkyfcfsa-l}}
 +
{{#set: molecular-weight=258.121}}

Revision as of 14:20, 26 August 2019

Metabolite MANNOSE-6P

  • common-name:
    • α-d-mannopyranose 6-phosphate
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(o)c(o)c(o)c(o)1)
  • inchi-key:
    • nbschqhzlsjfnq-pqmkyfcfsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality