Difference between revisions of "SJ22215"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7222 CPD-7222] == * common-name: ** (2e)-dodec-2-enoyl-coa * smiles: ** cccccccccc=cc(sccnc...")
(Created page with "Category:gene == Gene SJ20287 == * transcription-direction: ** positive * right-end-position: ** 192924 * left-end-position: ** 172907 * centisome-position: ** 82.59547...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7222 CPD-7222] ==
+
== Gene SJ20287 ==
* common-name:
+
* transcription-direction:
** (2e)-dodec-2-enoyl-coa
+
** positive
* smiles:
+
* right-end-position:
** cccccccccc=cc(sccnc(ccnc(c(c(cop(op(occ3(oc(n2(c1(=c(c(=nc=n1)n)n=c2)))c(c3op([o-])([o-])=o)o))([o-])=o)([o-])=o)(c)c)o)=o)=o)=o
+
** 192924
* inchi-key:
+
* left-end-position:
** irfyvbulxzmede-xcfippspsa-j
+
** 172907
* molecular-weight:
+
* centisome-position:
** 943.792
+
** 82.59547   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[ECOAH5]]
+
* [[S.japonica_sterols_curated]]
* [[ECOAH5h]]
+
== Reaction(s) associated ==
* [[ECOAH5m]]
+
* [[PROTEIN-KINASE-RXN]]
* [[RXN-14262]]
+
** Category: [[annotation]]
* [[RXN-7931]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
== Reaction(s) known to produce the compound ==
+
{{#set: transcription-direction=positive}}
* [[ACOA120OR]]
+
{{#set: right-end-position=192924}}
* [[ECOAH5]]
+
{{#set: left-end-position=172907}}
* [[ECOAH5h]]
+
{{#set: centisome-position=82.59547    }}
* [[ECOAH5m]]
+
{{#set: organism associated=S.japonica_sterols_curated}}
* [[RXN-14262]]
+
{{#set: nb reaction associated=1}}
* [[RXN-7931]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=(2e)-dodec-2-enoyl-coa}}
 
{{#set: inchi-key=inchikey=irfyvbulxzmede-xcfippspsa-j}}
 
{{#set: molecular-weight=943.792}}
 

Revision as of 20:20, 18 December 2020

Gene SJ20287

  • transcription-direction:
    • positive
  • right-end-position:
    • 192924
  • left-end-position:
    • 172907
  • centisome-position:
    • 82.59547

Organism(s) associated with this gene

Reaction(s) associated