Difference between revisions of "SJ07024"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P3I P3I] == * common-name: ** pppi * smiles: ** [o-]p(op(=o)(op([o-])(=o)[o-])[o-])([o-])=o * i...") |
(Created page with "Category:gene == Gene SJ14687 == * transcription-direction: ** negative * right-end-position: ** 5864 * left-end-position: ** 861 * centisome-position: ** 0.27720183 =...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ14687 == |
− | * | + | * transcription-direction: |
− | ** | + | ** negative |
− | * | + | * right-end-position: |
− | ** | + | ** 5864 |
− | * | + | * left-end-position: |
− | ** | + | ** 861 |
− | * | + | * centisome-position: |
− | ** | + | ** 0.27720183 |
− | == | + | == Organism(s) associated with this gene == |
− | * [[ | + | * [[S.japonica_sterols_curated]] |
− | == Reaction(s) | + | == Reaction(s) associated == |
− | * [[ | + | * [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]] |
− | * [[ | + | ** Category: [[annotation]] |
− | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | + | {{#set: transcription-direction=negative}} | |
− | + | {{#set: right-end-position=5864}} | |
− | = | + | {{#set: left-end-position=861}} |
− | {{#set: | + | {{#set: centisome-position=0.27720183 }} |
− | {{#set: | + | {{#set: organism associated=S.japonica_sterols_curated}} |
− | {{#set: | + | {{#set: nb reaction associated=1}} |
Revision as of 20:20, 18 December 2020
Gene SJ14687
- transcription-direction:
- negative
- right-end-position:
- 5864
- left-end-position:
- 861
- centisome-position:
- 0.27720183
Organism(s) associated with this gene
Reaction(s) associated
- HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation