Difference between revisions of "SJ20730"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] == * common-name: ** pinocembrin chalcone * smiles: ** c2(c=cc(c=cc(c1(=c(c=...")
(Created page with "Category:gene == Gene SJ05887 == * transcription-direction: ** negative * right-end-position: ** 358544 * left-end-position: ** 289491 * centisome-position: ** 59.739613...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] ==
+
== Gene SJ05887 ==
* common-name:
+
* transcription-direction:
** pinocembrin chalcone
+
** negative
* smiles:
+
* right-end-position:
** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2)
+
** 358544
* inchi-key:
+
* left-end-position:
** loyxtwzxlwhmbx-votsokgwsa-n
+
** 289491
* molecular-weight:
+
* centisome-position:
** 256.257
+
** 59.739613   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-7647]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-7645]]
+
* [[PROTEIN-KINASE-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=pinocembrin chalcone}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=loyxtwzxlwhmbx-votsokgwsa-n}}
+
** Category: [[orthology]]
{{#set: molecular-weight=256.257}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
* [[RXN-8443]]
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
* [[TAU-PROTEIN-KINASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-5381]]
 +
** '''6''' reactions found over '''11''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=358544}}
 +
{{#set: left-end-position=289491}}
 +
{{#set: centisome-position=59.739613    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=3}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:20, 18 December 2020

Gene SJ05887

  • transcription-direction:
    • negative
  • right-end-position:
    • 358544
  • left-end-position:
    • 289491
  • centisome-position:
    • 59.739613

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5381
    • 6 reactions found over 11 reactions in the full pathway