Difference between revisions of "SJ10331"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXIDIZED-GLUTATHIONE OXIDIZED-GLUTATHIONE] == * common-name: ** glutathione disulfide * smiles:...")
(Created page with "Category:gene == Gene SJ05967 == * transcription-direction: ** positive * right-end-position: ** 29209 * left-end-position: ** 2960 * centisome-position: ** 3.433755 =...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OXIDIZED-GLUTATHIONE OXIDIZED-GLUTATHIONE] ==
+
== Gene SJ05967 ==
−
* common-name:
+
* transcription-direction:
−
** glutathione disulfide
+
** positive
−
* smiles:
+
* right-end-position:
−
** c(sscc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
+
** 29209
−
* inchi-key:
+
* left-end-position:
−
** ypzrwbkmtbyptk-bjdjzhngsa-l
+
** 2960
−
* molecular-weight:
+
* centisome-position:
−
** 610.61
+
** 3.433755   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[GDR]]
+
* [[S.japonica_sterols_curated]]
−
* [[GDR_LPAREN_nadp_RPAREN_]]
+
== Reaction(s) associated ==
−
* [[GDR_LPAREN_nadp_RPAREN_h]]
+
* [[RXN-16291]]
−
* [[GDR_LPAREN_nadp_RPAREN_m]]
+
** Category: [[annotation]]
−
* [[GDRh]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[GDRm]]
+
* [[RXN-16292]]
−
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
+
** Category: [[annotation]]
−
== Reaction(s) known to produce the compound ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[1.11.1.12-RXN]]
+
* [[RXN-16293]]
−
* [[1.8.4.9-RXN]]
+
** Category: [[annotation]]
−
* [[1.8.5.1-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[GLUTATHIONE-PEROXIDASE-RXN]]
+
* [[RXN-16294]]
−
* [[GTHP]]
+
** Category: [[annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: common-name=glutathione disulfide}}
+
* [[RXN-16991]]
−
{{#set: inchi-key=inchikey=ypzrwbkmtbyptk-bjdjzhngsa-l}}
+
** Category: [[annotation]]
−
{{#set: molecular-weight=610.61}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-7706]]
 +
** '''4''' reactions found over '''13''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=29209}}
 +
{{#set: left-end-position=2960}}
 +
{{#set: centisome-position=3.433755    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=5}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:20, 18 December 2020

Gene SJ05967

  • transcription-direction:
    • positive
  • right-end-position:
    • 29209
  • left-end-position:
    • 2960
  • centisome-position:
    • 3.433755

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7706
    • 4 reactions found over 13 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ10331&oldid=41068"