Difference between revisions of "SJ04208"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12120 CPD-12120] == * common-name: ** demethylmenaquinol-11 * smiles: ** cc(=cccc(=cccc(=cc...")
(Created page with "Category:gene == Gene SJ05236 == * transcription-direction: ** positive * right-end-position: ** 92444 * left-end-position: ** 81677 * centisome-position: ** 85.840256...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12120 CPD-12120] ==
+
== Gene SJ05236 ==
* common-name:
+
* transcription-direction:
** demethylmenaquinol-11
+
** positive
* smiles:
+
* right-end-position:
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c
+
** 92444
* inchi-key:
+
* left-end-position:
** wvrzwraihitkpi-sokmhqjssa-n
+
** 81677
* molecular-weight:
+
* centisome-position:
** 909.472
+
** 85.840256   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-9362]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[3.4.19.12-RXN]]
{{#set: common-name=demethylmenaquinol-11}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=wvrzwraihitkpi-sokmhqjssa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=909.472}}
+
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=92444}}
 +
{{#set: left-end-position=81677}}
 +
{{#set: centisome-position=85.840256    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:20, 18 December 2020

Gene SJ05236

  • transcription-direction:
    • positive
  • right-end-position:
    • 92444
  • left-end-position:
    • 81677
  • centisome-position:
    • 85.840256

Organism(s) associated with this gene

Reaction(s) associated