Difference between revisions of "SJ10758"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] == * common-name: ** docosahexaenoate * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-I-CIT HOMO-I-CIT] == * common-name: ** (1r,2s)-homoisocitrate * smiles: ** c(cc(=o)[o-])c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-I-CIT HOMO-I-CIT] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (1r,2s)-homoisocitrate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(cc(=o)[o-])c(c(=o)[o-])c(o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** oejzzcgrgvfwhk-wvzvxsggsa-k |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 203.128 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[HOMOACONITATE-HYDRATASE-RXN]] |
| + | * [[RXN-13722]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[HOMOACONITATE-HYDRATASE-RXN]] |
| − | + | * [[RXN-13722]] | |
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(1r,2s)-homoisocitrate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oejzzcgrgvfwhk-wvzvxsggsa-k}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=203.128}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite HOMO-I-CIT
- common-name:
- (1r,2s)-homoisocitrate
- smiles:
- c(cc(=o)[o-])c(c(=o)[o-])c(o)c(=o)[o-]
- inchi-key:
- oejzzcgrgvfwhk-wvzvxsggsa-k
- molecular-weight:
- 203.128
