Difference between revisions of "SJ21573"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-606 CPD-606] == * common-name: ** cdp-glycerol * smiles: ** c(o)c(o)cop(op(occ2(c(c(c(n1(c(...")
(Created page with "Category:gene == Gene SJ00224 == * transcription-direction: ** positive * right-end-position: ** 510036 * left-end-position: ** 486161 * centisome-position: ** 85.33542...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-606 CPD-606] ==
+
== Gene SJ00224 ==
* common-name:
+
* transcription-direction:
** cdp-glycerol
+
** positive
* smiles:
+
* right-end-position:
** c(o)c(o)cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))(=o)[o-])(=o)[o-]
+
** 510036
* inchi-key:
+
* left-end-position:
** hhpouccvoneprk-jbsykwbfsa-l
+
** 486161
* molecular-weight:
+
* centisome-position:
** 475.242
+
** 85.33542   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[CDP-GLYCEROL-PYROPHOSPHATASE-RXN]]
+
* [[RXN-15559]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=cdp-glycerol}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=hhpouccvoneprk-jbsykwbfsa-l}}
+
* [[RXN-15560]]
{{#set: molecular-weight=475.242}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-7511]]
 +
** '''7''' reactions found over '''9''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=510036}}
 +
{{#set: left-end-position=486161}}
 +
{{#set: centisome-position=85.33542    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=3}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:20, 18 December 2020

Gene SJ00224

  • transcription-direction:
    • positive
  • right-end-position:
    • 510036
  • left-end-position:
    • 486161
  • centisome-position:
    • 85.33542

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7511
    • 7 reactions found over 9 reactions in the full pathway