Difference between revisions of "SJ00387"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TTP TTP] == * common-name: ** dttp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(...")
(Created page with "Category:gene == Gene SJ17528 == * transcription-direction: ** negative * right-end-position: ** 15584 * left-end-position: ** 12971 * centisome-position: ** 4.9769974...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TTP TTP] ==
+
== Gene SJ17528 ==
* common-name:
+
* transcription-direction:
** dttp
+
** negative
* smiles:
+
* right-end-position:
** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])o2))
+
** 15584
* inchi-key:
+
* left-end-position:
** nhvnxkfizysceb-xlpzgreqsa-j
+
** 12971
* molecular-weight:
+
* centisome-position:
** 478.139
+
** 4.9769974   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[DTTGY]]
+
* [[S.japonica_sterols_curated]]
* [[DTTPtm]]
+
== Reaction(s) associated ==
* [[DTTUP]]
+
* [[RXN-13685]]
* [[RXN-14200]]
+
** Category: [[annotation]]
* [[RXN0-5107]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[THYMIDINE-TRIPHOSPHATASE-RXN]]
+
* [[RXN-17897]]
== Reaction(s) known to produce the compound ==
+
** Category: [[orthology]]
* [[ATDTD]]
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
* [[ATDTDm]]
+
== Pathway(s) associated ==
* [[DTDPKIN-RXN]]
+
* [[PWY-7230]]
* [[DTTPtm]]
+
** '''3''' reactions found over '''9''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
{{#set: transcription-direction=negative}}
{{#set: common-name=dttp}}
+
{{#set: right-end-position=15584}}
{{#set: inchi-key=inchikey=nhvnxkfizysceb-xlpzgreqsa-j}}
+
{{#set: left-end-position=12971}}
{{#set: molecular-weight=478.139}}
+
{{#set: centisome-position=4.9769974    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:21, 18 December 2020

Gene SJ17528

  • transcription-direction:
    • negative
  • right-end-position:
    • 15584
  • left-end-position:
    • 12971
  • centisome-position:
    • 4.9769974

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7230
    • 3 reactions found over 9 reactions in the full pathway