Difference between revisions of "SJ11352"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-1-P GLC-1-P] == * common-name: ** α-d-glucopyranose 1-phosphate * smiles: ** c(o)c1(o...")
(Created page with "Category:gene == Gene SJ14111 == * transcription-direction: ** positive * right-end-position: ** 52702 * left-end-position: ** 39016 * centisome-position: ** 11.999164...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-1-P GLC-1-P] ==
+
== Gene SJ14111 ==
* common-name:
+
* transcription-direction:
** α-d-glucopyranose 1-phosphate
+
** positive
* smiles:
+
* right-end-position:
** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
+
** 52702
* inchi-key:
+
* left-end-position:
** hxxfsfrbohsimq-vfuothlcsa-l
+
** 39016
* molecular-weight:
+
* centisome-position:
** 258.121
+
** 11.999164   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[GALACTURIDYLYLTRANS-RXN]]
+
* [[S.japonica_sterols_curated]]
* [[GLUC1PURIDYLTRANS-RXN]]
+
== Reaction(s) associated ==
* [[PGCM]]
+
* [[ATPASE-RXN]]
* [[PGMTh]]
+
** Category: [[annotation]]
* [[PHOSPHOGLUCMUT-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-12486]]
+
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
* [[RXN-16997]]
+
** Category: [[annotation]]
* [[RXN4FS-13]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[UG1PUT]]
+
* [[RXN-12195]]
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
* [[GALACTURIDYLYLTRANS-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[GLUC1PURIDYLTRANS-RXN]]
+
* [[RXN-12196]]
* [[GLYCOPHOSPHORYL-RXN]]
+
** Category: [[annotation]]
* [[GLYMALTOPHOSPHORYL-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[PGCM]]
+
* [[RXN0-5462]]
* [[PGMTh]]
+
** Category: [[annotation]]
* [[PHOSPHOGLUCMUT-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-12171]]
+
== Pathway(s) associated ==
* [[RXN-12392]]
+
* [[PWY-6545]]
* [[RXN-12486]]
+
** '''8''' reactions found over '''9''' reactions in the full pathway
* [[RXN-14284]]
+
* [[PWY-7210]]
* [[RXN-14285]]
+
** '''8''' reactions found over '''8''' reactions in the full pathway
* [[RXN-14286]]
+
* [[PWY-7198]]
* [[RXN-14353]]
+
** '''6''' reactions found over '''7''' reactions in the full pathway
* [[RXN-1826]]
+
* [[PWY-7184]]
* [[RXN-9025]]
+
** '''9''' reactions found over '''9''' reactions in the full pathway
* [[RXN0-5182]]
+
{{#set: transcription-direction=positive}}
* [[RXN0-5184]]
+
{{#set: right-end-position=52702}}
== Reaction(s) of unknown directionality ==
+
{{#set: left-end-position=39016}}
{{#set: common-name=α-d-glucopyranose 1-phosphate}}
+
{{#set: centisome-position=11.999164    }}
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-vfuothlcsa-l}}
+
{{#set: organism associated=S.japonica_sterols_curated}}
{{#set: molecular-weight=258.121}}
+
{{#set: nb reaction associated=5}}
 +
{{#set: nb pathway associated=4}}

Revision as of 20:21, 18 December 2020

Gene SJ14111

  • transcription-direction:
    • positive
  • right-end-position:
    • 52702
  • left-end-position:
    • 39016
  • centisome-position:
    • 11.999164

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6545
    • 8 reactions found over 9 reactions in the full pathway
  • PWY-7210
    • 8 reactions found over 8 reactions in the full pathway
  • PWY-7198
    • 6 reactions found over 7 reactions in the full pathway
  • PWY-7184
    • 9 reactions found over 9 reactions in the full pathway