Difference between revisions of "SJ15310"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-3-HYDROXYBUTANOYL-COA S-3-HYDROXYBUTANOYL-COA] == * common-name: ** (s)-3-hydroxybutanoyl-coa...")
(Created page with "Category:gene == Gene SJ02909 == * transcription-direction: ** negative * right-end-position: ** 179821 * left-end-position: ** 176496 * centisome-position: ** 33.232845...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-3-HYDROXYBUTANOYL-COA S-3-HYDROXYBUTANOYL-COA] ==
+
== Gene SJ02909 ==
−
* common-name:
+
* transcription-direction:
−
** (s)-3-hydroxybutanoyl-coa
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
+
** 179821
−
* inchi-key:
+
* left-end-position:
−
** qhhkkmyhdbrony-vkbdfprvsa-j
+
** 176496
−
* molecular-weight:
+
* centisome-position:
−
** 849.593
+
** 33.232845   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[HACD1h]]
+
* [[S.japonica_sterols_curated]]
−
* [[HBCHL]]
+
== Reaction(s) associated ==
−
* [[HBCHLm]]
+
* [[3.4.25.1-RXN]]
−
* [[HBCO]]
+
** Category: [[annotation]]
−
* [[HBCO_LPAREN_nadp_RPAREN_]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[HBCO_LPAREN_nadp_RPAREN_m]]
+
{{#set: transcription-direction=negative}}
−
* [[RXN-11662]]
+
{{#set: right-end-position=179821}}
−
* [[RXN-11667]]
+
{{#set: left-end-position=176496}}
−
== Reaction(s) known to produce the compound ==
+
{{#set: centisome-position=33.232845    }}
−
* [[3-HYDROXYBUTYRYL-COA-DEHYDROGENASE-RXN]]
+
{{#set: organism associated=S.japonica_sterols_curated}}
−
* [[HACD1h]]
+
{{#set: nb reaction associated=1}}
−
* [[HBCHL]]
 
−
* [[HBCHLm]]
 
−
* [[HBCO_LPAREN_nadp_RPAREN_]]
 
−
* [[HBCO_LPAREN_nadp_RPAREN_m]]
 
−
* [[RXN-11662]]
 
−
* [[RXN-11667]]
 
−
== Reaction(s) of unknown directionality ==
 
−
{{#set: common-name=(s)-3-hydroxybutanoyl-coa}}
 
−
{{#set: inchi-key=inchikey=qhhkkmyhdbrony-vkbdfprvsa-j}}
 
−
{{#set: molecular-weight=849.593}}
 

Revision as of 20:21, 18 December 2020

Gene SJ02909

  • transcription-direction:
    • negative
  • right-end-position:
    • 179821
  • left-end-position:
    • 176496
  • centisome-position:
    • 33.232845

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ15310&oldid=41541"