Difference between revisions of "SJ14767"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6972 CPD-6972] == * common-name: ** 4-(2'-carboxyphenyl)-4-oxobutyryl-coa * smiles: ** cc(c...")
(Created page with "Category:gene == Gene SJ21995 == * transcription-direction: ** negative * right-end-position: ** 168394 * left-end-position: ** 167741 * centisome-position: ** 91.82835...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6972 CPD-6972] ==
+
== Gene SJ21995 ==
−
* common-name:
+
* transcription-direction:
−
** 4-(2'-carboxyphenyl)-4-oxobutyryl-coa
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc(cop([o-])(=o)op([o-])(=o)occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])(=o)[o-]))(c)c(c(nccc(nccsc(ccc(c4(c=cc=cc(c([o-])=o)=4))=o)=o)=o)=o)o
+
** 168394
−
* inchi-key:
+
* left-end-position:
−
** kvaqapqxoxtrae-uhfffaoysa-i
+
** 167741
−
* molecular-weight:
+
* centisome-position:
−
** 966.676
+
** 91.82835   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[NAPHTHOATE-SYN-RXN]]
+
* [[S.japonica_sterols_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[NPHS]]
+
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
−
* [[O-SUCCINYLBENZOATE-COA-LIG-RXN]]
+
** Category: [[annotation]]
−
* [[RXN-7614]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
== Reaction(s) of unknown directionality ==
+
{{#set: transcription-direction=negative}}
−
{{#set: common-name=4-(2'-carboxyphenyl)-4-oxobutyryl-coa}}
+
{{#set: right-end-position=168394}}
−
{{#set: inchi-key=inchikey=kvaqapqxoxtrae-uhfffaoysa-i}}
+
{{#set: left-end-position=167741}}
−
{{#set: molecular-weight=966.676}}
+
{{#set: centisome-position=91.82835    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:21, 18 December 2020

Gene SJ21995

  • transcription-direction:
    • negative
  • right-end-position:
    • 168394
  • left-end-position:
    • 167741
  • centisome-position:
    • 91.82835

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ14767&oldid=41561"