Difference between revisions of "SJ16019"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8090 CPD-8090] == * common-name: ** 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine *...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-2-me-oxy-2-oxo-et-ur-34-tRNA 5-2-me-oxy-2-oxo-et-ur-34-tRNA] == * common-name: ** a 5-(2-meth...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8090 CPD-8090] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-2-me-oxy-2-oxo-et-ur-34-tRNA 5-2-me-oxy-2-oxo-et-ur-34-tRNA] ==
 
* common-name:
 
* common-name:
** 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine
+
** a 5-(2-methoxy-2-oxoethyl)uridine34 in trna
* smiles:
 
** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
 
* inchi-key:
 
** qfdyidgukxrpkh-vslglsmxsa-n
 
* molecular-weight:
 
** 780.076
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8331]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8323]]
+
* [[RXN-12461]]
* [[RXN-8330]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-α-linolenoyl-2-linoleoyl-phosphatidylcholine}}
+
{{#set: common-name=a 5-(2-methoxy-2-oxoethyl)uridine34 in trna}}
{{#set: inchi-key=inchikey=qfdyidgukxrpkh-vslglsmxsa-n}}
 
{{#set: molecular-weight=780.076}}
 

Revision as of 14:20, 26 August 2019

Metabolite 5-2-me-oxy-2-oxo-et-ur-34-tRNA

  • common-name:
    • a 5-(2-methoxy-2-oxoethyl)uridine34 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality