Difference between revisions of "SJ02869"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11527 CPD-11527] == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxyb...")
(Created page with "Category:gene == Gene SJ05424 == == Organism(s) associated with this gene == * S.japonica_sterols_curated == Reaction(s) associated == * NO3t ** Category: ortho...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11527 CPD-11527] ==
+
== Gene SJ05424 ==
* common-name:
+
== Organism(s) associated with this gene  ==
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxybutanoyl)-coa
+
* [[S.japonica_sterols_curated]]
* smiles:
+
== Reaction(s) associated ==
** ccc=ccc1(c(ccc(=o)1)cc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])
+
* [[NO3t]]
* inchi-key:
+
** Category: [[orthology]]
** yufhotsrmdfgns-gbypgrtbsa-j
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
* molecular-weight:
+
* [[TCV3]]
** 999.813
+
** Category: [[orthology]]
== Reaction(s) known to consume the compound ==
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
* [[RXN-10703]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
== Reaction(s) known to produce the compound ==
+
* [[TRANS-RXN-137]]
* [[RXN-10705]]
+
** Category: [[orthology]]
== Reaction(s) of unknown directionality ==
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3r-hydroxybutanoyl)-coa}}
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
{{#set: inchi-key=inchikey=yufhotsrmdfgns-gbypgrtbsa-j}}
+
{{#set: organism associated=S.japonica_sterols_curated}}
{{#set: molecular-weight=999.813}}
+
{{#set: nb reaction associated=3}}

Revision as of 20:21, 18 December 2020

Gene SJ05424

Organism(s) associated with this gene

Reaction(s) associated