Difference between revisions of "SJ04123"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-36 CPD-36] == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galacto...")
(Created page with "Category:gene == Gene SJ16890 == * transcription-direction: ** negative * right-end-position: ** 49524 * left-end-position: ** 8160 * centisome-position: ** 2.9598355...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-36 CPD-36] ==
+
== Gene SJ16890 ==
−
* common-name:
+
* transcription-direction:
−
** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc(=o)nc2(c(o)oc(co)c(o)c(oc1(oc(c([o-])=o)=cc(o)c(o)1))2)
+
** 49524
−
* inchi-key:
+
* left-end-position:
−
** dlgjwsvwtwewbj-ztvljyeesa-m
+
** 8160
−
* molecular-weight:
+
* centisome-position:
−
** 378.312
+
** 2.9598355   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-12178]]
+
* [[S.japonica_sterols_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
−
{{#set: common-name=4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl-d-galactosamine}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=dlgjwsvwtwewbj-ztvljyeesa-m}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=378.312}}
+
== Pathway(s) associated ==
 +
* [[PWY-7511]]
 +
** '''7''' reactions found over '''9''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=49524}}
 +
{{#set: left-end-position=8160}}
 +
{{#set: centisome-position=2.9598355    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:21, 18 December 2020

Gene SJ16890

  • transcription-direction:
    • negative
  • right-end-position:
    • 49524
  • left-end-position:
    • 8160
  • centisome-position:
    • 2.9598355

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-7511
    • 7 reactions found over 9 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ04123&oldid=41651"