Difference between revisions of "SJ18196"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SPERMINE SPERMINE] == * common-name: ** spermine * smiles: ** c(ccc[n+]ccc[n+])[n+]ccc[n+] * in...") |
(Created page with "Category:gene == Gene SJ06975 == * transcription-direction: ** positive * right-end-position: ** 256133 * left-end-position: ** 242827 * centisome-position: ** 52.049374...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:gene]] |
| − | == | + | == Gene SJ06975 == |
| − | * | + | * transcription-direction: |
| − | ** | + | ** positive |
| − | * | + | * right-end-position: |
| − | ** | + | ** 256133 |
| − | * | + | * left-end-position: |
| − | ** | + | ** 242827 |
| − | * | + | * centisome-position: |
| − | ** | + | ** 52.049374 |
| − | == | + | == Organism(s) associated with this gene == |
| − | == Reaction(s) | + | * [[S.japonica_sterols_curated]] |
| − | * [[ | + | == Reaction(s) associated == |
| − | == | + | * [[2.4.1.223-RXN]] |
| − | {{#set: | + | ** Category: [[annotation]] |
| − | {{#set: | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
| − | {{#set: | + | * [[2.4.1.229-RXN]] |
| + | ** Category: [[annotation]] | ||
| + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | ||
| + | ** Category: [[orthology]] | ||
| + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | ||
| + | == Pathway(s) associated == | ||
| + | * [[PWY-6558]] | ||
| + | ** '''7''' reactions found over '''13''' reactions in the full pathway | ||
| + | {{#set: transcription-direction=positive}} | ||
| + | {{#set: right-end-position=256133}} | ||
| + | {{#set: left-end-position=242827}} | ||
| + | {{#set: centisome-position=52.049374 }} | ||
| + | {{#set: organism associated=S.japonica_sterols_curated}} | ||
| + | {{#set: nb reaction associated=2}} | ||
| + | {{#set: nb pathway associated=1}} | ||
Revision as of 20:21, 18 December 2020
Contents
Gene SJ06975
- transcription-direction:
- positive
- right-end-position:
- 256133
- left-end-position:
- 242827
- centisome-position:
- 52.049374
Organism(s) associated with this gene
Reaction(s) associated
- 2.4.1.223-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- 2.4.1.229-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: annotation
Pathway(s) associated
- PWY-6558
- 7 reactions found over 13 reactions in the full pathway
