Difference between revisions of "SJ02953"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19148 CPD-19148] == * common-name: ** (5z)-dodecenoyl-coa * smiles: ** ccccccc=ccccc(=o)scc...")
(Created page with "Category:gene == Gene SJ10775 == * transcription-direction: ** positive * right-end-position: ** 8481 * left-end-position: ** 7612 * centisome-position: ** 1.9788235 =...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19148 CPD-19148] ==
+
== Gene SJ10775 ==
−
* common-name:
+
* transcription-direction:
−
** (5z)-dodecenoyl-coa
+
** positive
−
* smiles:
+
* right-end-position:
−
** ccccccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 8481
−
* inchi-key:
+
* left-end-position:
−
** rcvjzgbrlgutkt-cggpsvllsa-j
+
** 7612
−
* molecular-weight:
+
* centisome-position:
−
** 943.792
+
** 1.9788235   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-17796]]
+
* [[S.japonica_sterols_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[RXN-17795]]
+
* [[3.1.26.4-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=(5z)-dodecenoyl-coa}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=rcvjzgbrlgutkt-cggpsvllsa-j}}
+
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
−
{{#set: molecular-weight=943.792}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=8481}}
 +
{{#set: left-end-position=7612}}
 +
{{#set: centisome-position=1.9788235    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=3}}

Revision as of 20:22, 18 December 2020

Gene SJ10775

  • transcription-direction:
    • positive
  • right-end-position:
    • 8481
  • left-end-position:
    • 7612
  • centisome-position:
    • 1.9788235

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ02953&oldid=41961"