Difference between revisions of "SJ11943"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17545 CPD-17545] == * common-name: ** 3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l...")
(Created page with "Category:gene == Gene SJ15480 == * transcription-direction: ** negative * right-end-position: ** 100723 * left-end-position: ** 100292 * centisome-position: ** 33.971607...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17545 CPD-17545] ==
+
== Gene SJ15480 ==
* common-name:
+
* transcription-direction:
** 3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l-alanine
+
** negative
* smiles:
+
* right-end-position:
** c([n+])c(c([o-])=o)nc(=o)c1(oc(c(=o)n)1)
+
** 100723
* inchi-key:
+
* left-end-position:
** neroffugairxgm-wxjvfsnfsa-n
+
** 100292
* molecular-weight:
+
* centisome-position:
** 217.181
+
** 33.971607   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-16294]]
+
* [[S.japonica_sterols_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-16294]]
+
* [[R621-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=3-({[(2r,3r)-3-carbamoyloxiran-2-yl]carbonyl}amino)-l-alanine}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=neroffugairxgm-wxjvfsnfsa-n}}
+
{{#set: transcription-direction=negative}}
{{#set: molecular-weight=217.181}}
+
{{#set: right-end-position=100723}}
 +
{{#set: left-end-position=100292}}
 +
{{#set: centisome-position=33.971607    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:22, 18 December 2020

Gene SJ15480

  • transcription-direction:
    • negative
  • right-end-position:
    • 100723
  • left-end-position:
    • 100292
  • centisome-position:
    • 33.971607

Organism(s) associated with this gene

Reaction(s) associated