Difference between revisions of "SJ14039"

Revision as of 14:20, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7733 CPD-7733] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PRECURSOR-Z PRECURSOR-Z] ==
 * common-name:
-** aurachin c
+** cyclic pyranopterin phosphate
 * smiles:
-** cc(c)=cccc(c)=cccc(c)=ccc2(c(c1(c=cc=cc=1n(c(c)=2)o))=o)
+** c1(op([o-])(=o)oc2(c1o[ch]3([ch](c(=o)2)nc4(=c(n3)n=c(n)nc(=o)4))))
 * inchi-key:
-** fihxchbehlcxeg-yefhwucqsa-n
+** pwfxlxmpgsleoz-qqvwsjfjsa-m
 * molecular-weight:
-** 379.541
+** 344.2
 == Reaction(s) known to consume the compound ==
-* [[RXN-15029]]
-* [[RXN-17335]]
 == Reaction(s) known to produce the compound ==
+* [[RXN-17809]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=aurachin c}}
+{{#set: common-name=cyclic pyranopterin phosphate}}
-{{#set: inchi-key=inchikey=fihxchbehlcxeg-yefhwucqsa-n}}
+{{#set: inchi-key=inchikey=pwfxlxmpgsleoz-qqvwsjfjsa-m}}
-{{#set: molecular-weight=379.541}}
+{{#set: molecular-weight=344.2}}