Difference between revisions of "SJ01597"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYADIPYL-COA 3-HYDROXYADIPYL-COA] == * common-name: ** (3s)-hydroxyadipyl-coa * smiles:...")
(Created page with "Category:gene == Gene SJ06384 == * transcription-direction: ** negative * right-end-position: ** 176221 * left-end-position: ** 167579 * centisome-position: ** 35.207153...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYADIPYL-COA 3-HYDROXYADIPYL-COA] ==
+
== Gene SJ06384 ==
−
* common-name:
+
* transcription-direction:
−
** (3s)-hydroxyadipyl-coa
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc(=o)[o-])o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 176221
−
* inchi-key:
+
* left-end-position:
−
** oteacgaedcimbs-notshufbsa-i
+
** 167579
−
* molecular-weight:
+
* centisome-position:
−
** 906.621
+
** 35.207153   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-2425]]
+
* [[S.japonica_sterols_curated]]
−
* [[RXN0-2044]]
+
== Reaction(s) associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[2.4.1.223-RXN]]
−
* [[RXN-2425]]
+
** Category: [[annotation]]
−
* [[RXN0-2044]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
== Reaction(s) of unknown directionality ==
+
* [[2.4.1.229-RXN]]
−
{{#set: common-name=(3s)-hydroxyadipyl-coa}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=oteacgaedcimbs-notshufbsa-i}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=906.621}}
+
== Pathway(s) associated ==
 +
* [[PWY-6558]]
 +
** '''7''' reactions found over '''13''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=176221}}
 +
{{#set: left-end-position=167579}}
 +
{{#set: centisome-position=35.207153    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:22, 18 December 2020

Gene SJ06384

  • transcription-direction:
    • negative
  • right-end-position:
    • 176221
  • left-end-position:
    • 167579
  • centisome-position:
    • 35.207153

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6558
    • 7 reactions found over 13 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ01597&oldid=42012"