Difference between revisions of "SJ00093"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMOGENTISATE HOMOGENTISATE] == * common-name: ** homogentisate * smiles: ** c1(c(=cc(=c(c=1)o)...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14758 CPD-14758] == * common-name: ** furfuryl thiol * smiles: ** c1(oc(cs)=cc=1) * inchi-k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMOGENTISATE HOMOGENTISATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14758 CPD-14758] ==
 
* common-name:
 
* common-name:
** homogentisate
+
** furfuryl thiol
 
* smiles:
 
* smiles:
** c1(c(=cc(=c(c=1)o)cc([o-])=o)o)
+
** c1(oc(cs)=cc=1)
 
* inchi-key:
 
* inchi-key:
** igmnyecmumzddf-uhfffaoysa-m
+
** zfftzdqkixpdaf-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 167.141
+
** 114.162
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14929]]
+
* [[RXN-13727]]
* [[RXN-2541]]
 
* [[RXN-2761]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
 
* [[HPPD]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=homogentisate}}
+
{{#set: common-name=furfuryl thiol}}
{{#set: inchi-key=inchikey=igmnyecmumzddf-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=zfftzdqkixpdaf-uhfffaoysa-n}}
{{#set: molecular-weight=167.141}}
+
{{#set: molecular-weight=114.162}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-14758

  • common-name:
    • furfuryl thiol
  • smiles:
    • c1(oc(cs)=cc=1)
  • inchi-key:
    • zfftzdqkixpdaf-uhfffaoysa-n
  • molecular-weight:
    • 114.162

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality