Difference between revisions of "SJ05891"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYTOCHROMOBILIN 3Z-PHYTOCHROMOBILIN] == * common-name: ** (3z)-phytochromobilin * smiles: *...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] == * common-name: ** (2s)-2-isopropyl-3-oxosuccinate * smiles: ** cc(c(c(=o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYTOCHROMOBILIN 3Z-PHYTOCHROMOBILIN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] ==
 
* common-name:
 
* common-name:
** (3z)-phytochromobilin
+
** (2s)-2-isopropyl-3-oxosuccinate
 
* smiles:
 
* smiles:
** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)=c(c)c(=n2)c=c3(c(c)=c(c=c)c(=o)n3)))n4))=o)
+
** cc(c(c(=o)[o-])c(=o)c(=o)[o-])c
 
* inchi-key:
 
* inchi-key:
** dkmlmzvdtgoegu-aikfxvfzsa-l
+
** hiizagqwabamrr-bypyzucnsa-l
 
* molecular-weight:
 
* molecular-weight:
** 582.655
+
** 172.137
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.3.7.4-RXN]]
+
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
 +
* [[IMDH]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3z)-phytochromobilin}}
+
{{#set: common-name=(2s)-2-isopropyl-3-oxosuccinate}}
{{#set: inchi-key=inchikey=dkmlmzvdtgoegu-aikfxvfzsa-l}}
+
{{#set: inchi-key=inchikey=hiizagqwabamrr-bypyzucnsa-l}}
{{#set: molecular-weight=582.655}}
+
{{#set: molecular-weight=172.137}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-7100

  • common-name:
    • (2s)-2-isopropyl-3-oxosuccinate
  • smiles:
    • cc(c(c(=o)[o-])c(=o)c(=o)[o-])c
  • inchi-key:
    • hiizagqwabamrr-bypyzucnsa-l
  • molecular-weight:
    • 172.137

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality