Difference between revisions of "SJ14012"

Revision as of 14:20, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALL-TRANS-HEXAPRENYL-DIPHOSPHATE ALL-TRANS-HEXAPRENYL-DIPHOSPHATE] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19010 CPD-19010] ==
 * common-name:
-** all-trans-hexaprenyl diphosphate
+** 1,2-epoxy-2-methylpropane
 * smiles:
-** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
+** cc1(c)(oc1)
 * inchi-key:
-** ngfsmhkftzrokj-mmszmyibsa-k
+** gelkghvafrcjna-uhfffaoysa-n
 * molecular-weight:
-** 583.66
+** 72.107
 == Reaction(s) known to consume the compound ==
-* [[RXN-9003]]
+* [[RXN-17589]]
 == Reaction(s) known to produce the compound ==
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=all-trans-hexaprenyl diphosphate}}
+{{#set: common-name=1,2-epoxy-2-methylpropane}}
-{{#set: inchi-key=inchikey=ngfsmhkftzrokj-mmszmyibsa-k}}
+{{#set: inchi-key=inchikey=gelkghvafrcjna-uhfffaoysa-n}}
-{{#set: molecular-weight=583.66}}
+{{#set: molecular-weight=72.107}}