Difference between revisions of "SJ08769"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-RIBULOSE-15-P2 D-RIBULOSE-15-P2] == * common-name: ** d-ribulose-1,5-bisphosphate * smiles: *...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13397 CPD-13397] == * common-name: ** l-alanyl-l-threonine * smiles: ** cc([n+])c(=o)nc(c(o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13397 CPD-13397] == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-alanyl-l-threonine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc([n+])c(=o)nc(c(o)c)c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** buqichwnxbibog-lmvfsukvsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 190.199 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-6980]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-alanyl-l-threonine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=buqichwnxbibog-lmvfsukvsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=190.199}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-13397
- common-name:
- l-alanyl-l-threonine
- smiles:
- cc([n+])c(=o)nc(c(o)c)c([o-])=o
- inchi-key:
- buqichwnxbibog-lmvfsukvsa-n
- molecular-weight:
- 190.199
