Difference between revisions of "SJ19604"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-ISOVALERYL-COA 3-HYDROXY-ISOVALERYL-COA] == * common-name: ** 3-hydroxyisovaleryl-coa...")
(Created page with "Category:gene == Gene SJ10627 == * transcription-direction: ** positive * right-end-position: ** 92463 * left-end-position: ** 86041 * centisome-position: ** 22.226097...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-ISOVALERYL-COA 3-HYDROXY-ISOVALERYL-COA] ==
+
== Gene SJ10627 ==
−
* common-name:
+
* transcription-direction:
−
** 3-hydroxyisovaleryl-coa
+
** positive
−
* smiles:
+
* right-end-position:
−
** cc(cop(=o)([o-])op(=o)([o-])occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])([o-])=o))(c)c(c(nccc(nccsc(=o)cc(c)(c)o)=o)=o)o
+
** 92463
−
* inchi-key:
+
* left-end-position:
−
** pevzkilcbdeobt-uhfffaoysa-j
+
** 86041
−
* molecular-weight:
+
* centisome-position:
−
** 863.619
+
** 22.226097   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
* [[S.japonica_sterols_curated]]
−
* [[RXN-14266]]
+
== Reaction(s) associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[3.1.3.16-RXN]]
−
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
** Category: [[annotation]]
−
* [[RXN-14266]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
== Reaction(s) of unknown directionality ==
+
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
−
{{#set: common-name=3-hydroxyisovaleryl-coa}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=pevzkilcbdeobt-uhfffaoysa-j}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=863.619}}
+
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=92463}}
 +
{{#set: left-end-position=86041}}
 +
{{#set: centisome-position=22.226097    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=3}}

Revision as of 20:22, 18 December 2020

Gene SJ10627

  • transcription-direction:
    • positive
  • right-end-position:
    • 92463
  • left-end-position:
    • 86041
  • centisome-position:
    • 22.226097

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ19604&oldid=42275"