Difference between revisions of "SJ05686"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11939 CPD-11939] == * common-name: ** 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetr...")
(Created page with "Category:gene == Gene SJ13513 == * transcription-direction: ** positive * right-end-position: ** 10688 * left-end-position: ** 3198 * centisome-position: ** 25.668192...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11939 CPD-11939] ==
+
== Gene SJ13513 ==
−
* common-name:
+
* transcription-direction:
−
** 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate
+
** positive
−
* smiles:
+
* right-end-position:
−
** c1(op([o-])([o-])=o)(c(op([o-])(=o)[o-])c(op(=o)([o-])op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])op([o-])(=o)[o-])c(op([o-])([o-])=o)1)
+
** 10688
−
* inchi-key:
+
* left-end-position:
−
** hhqooerqsfjgep-zsiqdkgesa-a
+
** 3198
−
* molecular-weight:
+
* centisome-position:
−
** 805.885
+
** 25.668192   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-10976]]
+
* [[S.japonica_sterols_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[RXN-10973]]
+
* [[PROTEIN-KINASE-RXN]]
−
* [[RXN-10976]]
+
** Category: [[annotation]]
−
* [[RXN-10979]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
== Reaction(s) of unknown directionality ==
+
{{#set: transcription-direction=positive}}
−
{{#set: common-name=3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate}}
+
{{#set: right-end-position=10688}}
−
{{#set: inchi-key=inchikey=hhqooerqsfjgep-zsiqdkgesa-a}}
+
{{#set: left-end-position=3198}}
−
{{#set: molecular-weight=805.885}}
+
{{#set: centisome-position=25.668192    }}
 +
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}

Revision as of 20:23, 18 December 2020

Gene SJ13513

  • transcription-direction:
    • positive
  • right-end-position:
    • 10688
  • left-end-position:
    • 3198
  • centisome-position:
    • 25.668192

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ05686&oldid=42307"