Difference between revisions of "SJ15480"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-609 CPD-609] == * common-name: ** p1,p4-bis(5'-guanosyl) tetraphosphate * smiles: ** c(op(=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SPERMINE SPERMINE] == * common-name: ** spermine * smiles: ** c(ccc[n+]ccc[n+])[n+]ccc[n+] * in...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-609 CPD-609] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SPERMINE SPERMINE] ==
 
* common-name:
 
* common-name:
** p1,p4-bis(5'-guanosyl) tetraphosphate
+
** spermine
 
* smiles:
 
* smiles:
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])op(=o)([o-])occ1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))))c4(oc(c(o)c(o)4)n6(c=nc5(c(=o)nc(n)=nc=56)))
+
** c(ccc[n+]ccc[n+])[n+]ccc[n+]
 
* inchi-key:
 
* inchi-key:
** olgwxcqxrssqpo-mharetsrsa-j
+
** pfnffqxmrsdohw-uhfffaoysa-r
 
* molecular-weight:
 
* molecular-weight:
** 864.359
+
** 206.374
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.6.1.17-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[SPERMINE-SYNTHASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=p1,p4-bis(5'-guanosyl) tetraphosphate}}
+
{{#set: common-name=spermine}}
{{#set: inchi-key=inchikey=olgwxcqxrssqpo-mharetsrsa-j}}
+
{{#set: inchi-key=inchikey=pfnffqxmrsdohw-uhfffaoysa-r}}
{{#set: molecular-weight=864.359}}
+
{{#set: molecular-weight=206.374}}

Revision as of 14:20, 26 August 2019

Metabolite SPERMINE

  • common-name:
    • spermine
  • smiles:
    • c(ccc[n+]ccc[n+])[n+]ccc[n+]
  • inchi-key:
    • pfnffqxmrsdohw-uhfffaoysa-r
  • molecular-weight:
    • 206.374

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality