Difference between revisions of "SJ13801"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DNA-Cytidines DNA-Cytidines] == * common-name: ** a 2'-deoxycytidine in dna == Reaction(s) know...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-GLU ACETYL-GLU] == * common-name: ** n-acetyl-l-glutamate * smiles: ** cc(=o)nc(c([o-])=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYL-GLU ACETYL-GLU] == |
* common-name: | * common-name: | ||
| − | ** | + | ** n-acetyl-l-glutamate |
| + | * smiles: | ||
| + | ** cc(=o)nc(c([o-])=o)ccc(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** rfmmmvdnipukgg-yfkpbyrvsa-l | ||
| + | * molecular-weight: | ||
| + | ** 187.152 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ACETYLGLUTKIN-RXN]] | ||
| + | * [[AGK]] | ||
| + | * [[N-ACETYLTRANSFER-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ACETYLGLUTKIN-RXN]] |
| + | * [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]] | ||
| + | * [[N-ACETYLTRANSFER-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-acetyl-l-glutamate}} |
| + | {{#set: inchi-key=inchikey=rfmmmvdnipukgg-yfkpbyrvsa-l}} | ||
| + | {{#set: molecular-weight=187.152}} | ||
Revision as of 14:20, 26 August 2019
Contents
Metabolite ACETYL-GLU
- common-name:
- n-acetyl-l-glutamate
- smiles:
- cc(=o)nc(c([o-])=o)ccc(=o)[o-]
- inchi-key:
- rfmmmvdnipukgg-yfkpbyrvsa-l
- molecular-weight:
- 187.152
